ChemNet > CAS > 1083-30-3 beta-Phenylpropiophenone
1083-30-3 beta-Phenylpropiophenone
상품명칭 |
beta-Phenylpropiophenone |
영문 이름 |
beta-Phenylpropiophenone; 1,3-Diphenyl-1-propanone; 1,3-diphenylpropan-1-one |
분자식 |
C15H14O |
분자량 |
210.2711 |
InChI |
InChI=1/C15H14O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10H,11-12H2 |
cas번호 |
1083-30-3 |
분자 구조 |
|
밀도 |
1.061g/cm3 |
비등점 |
352.7°C at 760 mmHg |
굴절 지수 |
1.574 |
인화점 |
152.9°C |
증기압 |
3.78E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|