ChemNet > CAS > 108485-13-8 4-Bromo-2,3-dimethyl-6-nitroaniline
108485-13-8 4-Bromo-2,3-dimethyl-6-nitroaniline
상품명칭 |
4-Bromo-2,3-dimethyl-6-nitroaniline |
영문 이름 |
4-Bromo-2,3-dimethyl-6-nitroaniline; 4-Bromo-6-nitro-2,3-xylidine |
분자식 |
C8H9BrN2O2 |
분자량 |
245.0733 |
InChI |
InChI=1/C8H9BrN2O2/c1-4-5(2)8(10)7(11(12)13)3-6(4)9/h3H,10H2,1-2H3 |
cas번호 |
108485-13-8 |
분자 구조 |
|
밀도 |
1.609g/cm3 |
비등점 |
357.9°C at 760 mmHg |
굴절 지수 |
1.632 |
인화점 |
170.3°C |
증기압 |
2.64E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|