ChemNet > CAS > 108847-20-7 Dibenzothiophene-4-boronic acid
108847-20-7 Dibenzothiophene-4-boronic acid
상품명칭 |
Dibenzothiophene-4-boronic acid |
영문 이름 |
Dibenzothiophene-4-boronic acid; Dibenzo[b,d]thiophen-4-ylboronic acid; 4-Dibenzothienylboronic acid; 4-DIBENZOTHIOPHENEBORONIC ACID |
분자식 |
C12H9BO2S |
분자량 |
228.0747 |
InChI |
InChI=1/C12H9BO2S/c14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10/h1-7,14-15H |
cas번호 |
108847-20-7 |
분자 구조 |
|
밀도 |
1.38g/cm3 |
녹는 점 |
327-330℃ |
비등점 |
480.2°C at 760 mmHg |
굴절 지수 |
1.738 |
인화점 |
244.2°C |
증기압 |
4.97E-10mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S22:;
S24/25:;
|
|