ChemNet > CAS > 108847-76-3 Thianthrene-1-boronic acid
108847-76-3 Thianthrene-1-boronic acid
상품명칭 |
Thianthrene-1-boronic acid |
영문 이름 |
Thianthrene-1-boronic acid; 1-Thianthrenylboronic acid; thianthren-1-ylboronic acid |
분자식 |
C12H9BO2S2 |
분자량 |
260.1397 |
InChI |
InChI=1/C12H9BO2S2/c14-13(15)8-4-3-7-11-12(8)17-10-6-2-1-5-9(10)16-11/h1-7,14-15H |
cas번호 |
108847-76-3 |
분자 구조 |
|
밀도 |
1.48g/cm3 |
녹는 점 |
146-149℃ |
비등점 |
472.7°C at 760 mmHg |
굴절 지수 |
1.756 |
인화점 |
239.7°C |
증기압 |
9.64E-10mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|