ChemNet > CAS > 109704-53-2 tetramethylammonium triacetoxy borohydride
109704-53-2 tetramethylammonium triacetoxy borohydride
상품명칭 |
tetramethylammonium triacetoxy borohydride |
영문 이름 |
tetramethylammonium triacetoxy borohydride; |
분자식 |
C10H22BNO6 |
분자량 |
263.0958 |
InChI |
InChI=1/C6H10BO6.C4H12N/c1-4(8)11-7(12-5(2)9)13-6(3)10;1-5(2,3)4/h7H,1-3H3;1-4H3/q-1;+1 |
cas번호 |
109704-53-2 |
분자 구조 |
|
녹는 점 |
93-98℃ |
위험성 표시 |
|
리스크 규칙 |
R15:Contact with water liberates highly flammable gases.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|