ChemNet > CAS > 1099-02-1 N,N,N',N'-1,4-Phenylenediaminetetraacetic acid
1099-02-1 N,N,N',N'-1,4-Phenylenediaminetetraacetic acid
상품명칭 |
N,N,N',N'-1,4-Phenylenediaminetetraacetic acid |
영문 이름 |
N,N,N',N'-1,4-Phenylenediaminetetraacetic acid;2,2',2'',2'''-(benzene-1,4-diyldinitrilo)tetraacetic acid |
분자식 |
C14H16N2O8 |
분자량 |
340.2854 |
InChI |
InChI=1/C14H16N2O8/c17-11(18)5-15(6-12(19)20)9-1-2-10(4-3-9)16(7-13(21)22)8-14(23)24/h1-4H,5-8H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
cas번호 |
1099-02-1 |
분자 구조 |
|
밀도 |
1.62g/cm3 |
비등점 |
744.2°C at 760 mmHg |
굴절 지수 |
1.683 |
인화점 |
403.9°C |
증기압 |
2.91E-23mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|