110-42-9 Methyl caprate
상품명칭 |
Methyl caprate |
영문 이름 |
Methyl caprate; Methyl decanoate; Capric acid methyl ester~Decanoic acid methyl ester~Methyl decanoate; METHYLE N-CAPRINATE |
분자식 |
C11H22O2 |
분자량 |
186.2912 |
InChI |
InChI=1/C11H22O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-10H2,1-2H3 |
cas번호 |
110-42-9 |
EC번호 |
203-766-6 |
분자 구조 |
|
밀도 |
0.872g/cm3 |
녹는 점 |
-11--14℃ |
비등점 |
224°C at 760 mmHg |
굴절 지수 |
1.426 |
인화점 |
94.4°C |
증기압 |
0.0934mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|