ChemNet > CAS > 110127-07-6 2,6-Dibromo-4-nitrotoluene
110127-07-6 2,6-Dibromo-4-nitrotoluene
상품명칭 |
2,6-Dibromo-4-nitrotoluene |
영문 이름 |
2,6-Dibromo-4-nitrotoluene;1,3-dibromo-2-methyl-5-nitrobenzene |
분자식 |
C7H5Br2NO2 |
분자량 |
294.9281 |
InChI |
InChI=1/C7H5Br2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
cas번호 |
110127-07-6 |
분자 구조 |
|
밀도 |
1.967g/cm3 |
비등점 |
320.4°C at 760 mmHg |
굴절 지수 |
1.625 |
인화점 |
147.6°C |
증기압 |
0.000598mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|