ChemNet > CAS > 110407-59-5 1-Bromo-2-chloro-4-fluorobenzene
110407-59-5 1-Bromo-2-chloro-4-fluorobenzene
| 상품명칭 |
1-Bromo-2-chloro-4-fluorobenzene |
| 영문 이름 |
1-Bromo-2-chloro-4-fluorobenzene; 4-Bromo-3-chlorofluorobenzene; 2-Chloro-4-Fluorobromobenzene |
| 분자식 |
C6H3BrClF |
| 분자량 |
209.4434 |
| InChI |
InChI=1/C6H3BrClF/c7-5-2-1-4(9)3-6(5)8/h1-3H |
| cas번호 |
110407-59-5 |
| 분자 구조 |
|
| 밀도 |
1.719g/cm3 |
| 비등점 |
196.3°C at 760 mmHg |
| 굴절 지수 |
1.55 |
| 인화점 |
72.5°C |
| 증기압 |
0.564mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
