상품명칭 |
2,4,7-트리니트로-9H-플루오렌-9-온 - 3,4,7-트리메틸-1-벤조티오펜(1:1) |
별명 |
; 2,4,7-Trinitrofluoren-9-one compd.with 3,4,7-trimethylbenzo (b)티오펜 (1:1); 플루오렌-9-온, 2,4,7-트리니트로-, compd.3,4,7-트리메틸벤조(B)티오펜(1:1) |
영문 이름 |
2,4,7-trinitro-9H-fluoren-9-one - 3,4,7-trimethyl-1-benzothiophene (1:1); 2,4,7-Trinitrofluoren-9-one compd. with 3,4,7-trimethylbenzo(b)thiophene (1:1); Fluoren-9-one, 2,4,7-trinitro-, compd. with 3,4,7-trimethylbenzo(b)thiophene (1:1) |
분자식 |
C24H17N3O7S |
분자량 |
491.4727 |
InChI |
InChI=1/C13H5N3O7.C11H12S/c17-13-9-3-6(14(18)19)1-2-8(9)12-10(13)4-7(15(20)21)5-11(12)16(22)23;1-7-4-5-8(2)11-10(7)9(3)6-12-11/h1-5H;4-6H,1-3H3 |
cas번호 |
1108-42-5 |
분자 구조 |
|
비등점 |
561.7°C at 760 mmHg |
인화점 |
292.3°C |
증기압 |
1.2E-12mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|