ChemNet > CAS > 110888-15-8 4-Chloro-3-fluorobenzonitrile
110888-15-8 4-Chloro-3-fluorobenzonitrile
상품명칭 |
4-Chloro-3-fluorobenzonitrile |
영문 이름 |
4-Chloro-3-fluorobenzonitrile; BUTTPARK 45\01-08; 3-Fluoro-4-Chlorobenzonitrile; 4-chloro-3-fluorobenzontrile |
분자식 |
C7H3ClFN |
분자량 |
155.5568 |
InChI |
InChI=1/C7H3ClFN/c8-6-2-1-5(4-10)3-7(6)9/h1-3H |
cas번호 |
110888-15-8 |
분자 구조 |
|
밀도 |
1.33g/cm3 |
녹는 점 |
79-81°C |
비등점 |
214°C at 760 mmHg |
굴절 지수 |
1.536 |
인화점 |
83.2°C |
증기압 |
0.159mmHg at 25°C |
위험성 표시 |
T,Xi:;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|