111-12-6;53073-28-2 Methyl 2-octynoate
상품명칭 |
Methyl 2-octynoate |
영문 이름 |
Methyl 2-octynoate; Methyl heptine carbonate; 2-Octynoic acid, methyl ester; FEMA No. 2729; Folione; Methyl 2-octinate; Methyl 2-octynate; Methyl hept-1-yne-1-carboxylate; Methyl pentylacetylenecarboxylate; Vert de violette, artificial; Methyl oct-2-ynoate |
분자식 |
C9H14O2 |
분자량 |
154.2063 |
InChI |
InChI=1/C9H14O2/c1-3-4-5-6-7-8-9(10)11-2/h3-6H2,1-2H3 |
cas번호 |
111-12-6;53073-28-2 |
EC번호 |
203-836-6 |
분자 구조 |
|
밀도 |
0.94g/cm3 |
비등점 |
218.5°C at 760 mmHg |
굴절 지수 |
1.443 |
인화점 |
88.9°C |
증기압 |
0.125mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|