111373-03-6 Cyanophenylpiperazine
상품명칭 |
Cyanophenylpiperazine |
영문 이름 |
Cyanophenylpiperazine; 1-(2-Cyanophenyl)piperazine; 2-(1-Piperazino)benzonitrile; 2-piperazin-1-ylbenzonitrile |
분자식 |
C11H13N3 |
분자량 |
187.241 |
InChI |
InChI=1/C11H13N3/c12-9-10-3-1-2-4-11(10)14-7-5-13-6-8-14/h1-4,13H,5-8H2 |
cas번호 |
111373-03-6 |
분자 구조 |
|
밀도 |
1.16g/cm3 |
비등점 |
369.4°C at 760 mmHg |
굴절 지수 |
1.602 |
인화점 |
177.2°C |
증기압 |
1.19E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|