ChemNet > CAS > 1117-31-3 1,3-butanediol diacetate
1117-31-3 1,3-butanediol diacetate
상품명칭 |
1,3-butanediol diacetate |
영문 이름 |
1,3-butanediol diacetate; 1,3-butylene diacetate; 1,3-Butylene glycol diacetate; butane-1,3-diyl diacetate; 1,3-BGDA; 1,3-Diacetoxybutane |
분자식 |
C8H14O4 |
분자량 |
174.1944 |
InChI |
InChI=1/C8H14O4/c1-6(12-8(3)10)4-5-11-7(2)9/h6H,4-5H2,1-3H3 |
cas번호 |
1117-31-3 |
EC번호 |
214-244-2 |
분자 구조 |
|
밀도 |
1.037g/cm3 |
비등점 |
228.8°C at 760 mmHg |
굴절 지수 |
1.421 |
인화점 |
102.6°C |
증기압 |
0.0722mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|