111787-91-8 (2-메틸-5-페닐-3-푸릴)메탄올
상품명칭 |
(2-메틸-5-페닐-3-푸릴)메탄올 |
별명 |
(2-메틸-5-페닐푸란-3-일)메탄올 |
영문 이름 |
(2-methyl-5-phenyl-3-furyl)methanol;(2-methyl-5-phenylfuran-3-yl)methanol |
분자식 |
C12H12O2 |
분자량 |
188.2225 |
InChI |
InChI=1/C12H12O2/c1-9-11(8-13)7-12(14-9)10-5-3-2-4-6-10/h2-7,13H,8H2,1H3 |
cas번호 |
111787-91-8 |
분자 구조 |
|
밀도 |
1.123g/cm3 |
녹는 점 |
22℃ |
비등점 |
233.9°C at 760 mmHg |
굴절 지수 |
1.562 |
인화점 |
95.2°C |
증기압 |
0.0302mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|