111821-49-9 4-보로노-D-페닐알라닌
상품명칭 |
4-보로노-D-페닐알라닌 |
별명 |
4-(디하이드록시보라닐)-D-페닐알라닌 |
영문 이름 |
4-Borono-D-phenylalanine;4-(dihydroxyboranyl)-D-phenylalanine |
분자식 |
C9H12BNO4 |
분자량 |
209.0069 |
InChI |
InChI=1/C9H12BNO4/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4,8,14-15H,5,11H2,(H,12,13)/t8-/m1/s1 |
cas번호 |
111821-49-9 |
분자 구조 |
|
밀도 |
1.34g/cm3 |
비등점 |
449.3°C at 760 mmHg |
굴절 지수 |
1.59 |
인화점 |
225.5°C |
증기압 |
7.39E-09mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|