1119-44-4 3-Hepten-2-one
상품명칭 |
3-Hepten-2-one |
영문 이름 |
3-Hepten-2-one;AI3-22032; Butylideneacetone; FEMA No. 3400; Methyl pentenyl ketone; (3E)-hept-3-en-2-one |
분자식 |
C7H12O |
분자량 |
112.1696 |
InChI |
InChI=1/C7H12O/c1-3-4-5-6-7(2)8/h5-6H,3-4H2,1-2H3/b6-5+ |
cas번호 |
1119-44-4 |
EC번호 |
214-278-8 |
분자 구조 |
|
밀도 |
0.832g/cm3 |
비등점 |
157.8°C at 760 mmHg |
굴절 지수 |
1.426 |
인화점 |
52.2°C |
증기압 |
2.7mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|