1119-46-6 5-Chlorovaleric acid
상품명칭 |
5-Chlorovaleric acid |
영문 이름 |
5-Chlorovaleric acid; 214-279-3; pentanoic acid, 5-chloro-; 5-chloropentanoic acid |
분자식 |
C5H9ClO2 |
분자량 |
136.5768 |
InChI |
InChI=1/C5H9ClO2/c6-4-2-1-3-5(7)8/h1-4H2,(H,7,8) |
cas번호 |
1119-46-6 |
EC번호 |
214-279-3 |
분자 구조 |
|
밀도 |
1.166g/cm3 |
녹는 점 |
18-20℃ |
비등점 |
230.9°C at 760 mmHg |
굴절 지수 |
1.452 |
인화점 |
93.4°C |
증기압 |
0.0227mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|