112-61-8 Methyl stearate
상품명칭 |
Methyl stearate |
영문 이름 |
Methyl stearate; Methyl n-octadecanoate; Stearic acid methyl ester; methyl octadecanoate; Me-ST |
분자식 |
C19H38O2 |
분자량 |
298.5038 |
InChI |
InChI=1/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
cas번호 |
112-61-8 |
EC번호 |
203-990-4 |
분자 구조 |
|
밀도 |
0.863g/cm3 |
녹는 점 |
37-39℃ |
비등점 |
355.5°C at 760 mmHg |
굴절 지수 |
1.444 |
인화점 |
169.3°C |
증기압 |
3.11E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|