1120-06-5 2-Decanol
상품명칭 |
2-Decanol |
영문 이름 |
2-Decanol; Methyl n-octyl carbinol; decan-2-ol; (2S)-decan-2-ol |
분자식 |
C10H22O |
분자량 |
158.2811 |
InChI |
InChI=1/C10H22O/c1-3-4-5-6-7-8-9-10(2)11/h10-11H,3-9H2,1-2H3/t10-/m0/s1 |
cas번호 |
1120-06-5 |
EC번호 |
214-296-6 |
분자 구조 |
|
밀도 |
0.826g/cm3 |
녹는 점 |
-5℃ |
비등점 |
212.2°C at 760 mmHg |
굴절 지수 |
1.434 |
인화점 |
85°C |
증기압 |
0.0393mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|