ChemNet > CAS > 112055-36-4 Ethyl 2-(4-chlorophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylate
112055-36-4 Ethyl 2-(4-chlorophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylate
상품명칭 |
Ethyl 2-(4-chlorophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylate |
영문 이름 |
Ethyl 2-(4-chlorophenyl)-3-(trifluoromethyl)pyrazole-4-carboxylate; Ethyl 1-(4-chlorophenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylate |
분자식 |
C6H4FI |
분자량 |
221.9988 |
InChI |
InChI=1/C6H4FI/c7-5-2-1-3-6(8)4-5/h1-4H |
cas번호 |
112055-36-4 |
EC번호 |
214-339-9 |
분자 구조 |
|
밀도 |
1.918g/cm3 |
녹는 점 |
52-54℃ |
비등점 |
183°C at 760 mmHg |
굴절 지수 |
1.591 |
인화점 |
67.2°C |
증기압 |
1.07mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|