1122-97-0 4-(Methylthio)thiophenol

상품명칭	4-(Methylthio)thiophenol
영문 이름	4-(Methylthio)thiophenol; 4-(Methylmercapto)thiophenol~4-(Methylthio)benzenethiol; 4-Mehyl Ithio Thiophenol; 4-(methylsulfanyl)benzenethiol
분자식	C₇H₈S₂
분자량	156.2684
InChI	InChI=1/C7H8S2/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3
cas번호	1122-97-0
분자 구조
밀도	1.16g/cm³
비등점	252.9°C at 760 mmHg
굴절 지수	1.621
인화점	106.7°C
증기압	0.03mmHg at 25°C
위험성 표시
리스크 규칙	R22:Harmful if swallowed.; R36/38:Irritating to eyes and skin.;
보안 규칙	S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;