ChemNet > CAS > 1124-08-9 1,4-Diiodo-2,5-dimethylbenzene
1124-08-9 1,4-Diiodo-2,5-dimethylbenzene
| 상품명칭 |
1,4-Diiodo-2,5-dimethylbenzene |
| 영문 이름 |
1,4-Diiodo-2,5-dimethylbenzene; 2,5-Diiodo-p-xylene
|
| 분자식 |
C8H8I2 |
| 분자량 |
357.9581 |
| InChI |
InChI=1/C8H8I2/c1-5-3-8(10)6(2)4-7(5)9/h3-4H,1-2H3 |
| cas번호 |
1124-08-9 |
| 분자 구조 |
|
| 밀도 |
2.154g/cm3 |
| 녹는 점 |
103℃ |
| 비등점 |
306.2°C at 760 mmHg |
| 굴절 지수 |
1.665 |
| 인화점 |
147.6°C |
| 증기압 |
0.00142mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
