1124-39-6 4-Ethylcatechol
상품명칭 |
4-Ethylcatechol |
영문 이름 |
4-Ethylcatechol; 3,4-Dihydroxyethylbenzene; 4-ethylbenzene-1,2-diol |
분자식 |
C8H10O2 |
분자량 |
138.1638 |
InChI |
InChI=1/C8H10O2/c1-2-6-3-4-7(9)8(10)5-6/h3-5,9-10H,2H2,1H3 |
cas번호 |
1124-39-6 |
EC번호 |
214-397-5 |
분자 구조 |
|
밀도 |
1.159g/cm3 |
비등점 |
273.3°C at 760 mmHg |
굴절 지수 |
1.578 |
인화점 |
134.1°C |
증기압 |
0.00346mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|