ChemNet > CAS > 1129-35-7 methyl 4-cyanobenzoate
1129-35-7 methyl 4-cyanobenzoate
| 상품명칭 |
methyl 4-cyanobenzoate |
| 영문 이름 |
methyl 4-cyanobenzoate; 4-Cyanobenzoic acid methyl ester; Cyanbenzoicacidmethylester; 4-Cy!nobenzoic acid methyl ester |
| 분자식 |
C9H7NO2 |
| 분자량 |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
| cas번호 |
1129-35-7 |
| EC번호 |
214-443-4 |
| 분자 구조 |
|
| 밀도 |
1.18g/cm3 |
| 녹는 점 |
62℃ |
| 비등점 |
274.9°C at 760 mmHg |
| 굴절 지수 |
1.535 |
| 인화점 |
131.2°C |
| 증기압 |
0.00526mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
