ChemNet > CAS > 113053-50-2 Methyl 1,2,3-benzotriazole-5-carboxylate
113053-50-2 Methyl 1,2,3-benzotriazole-5-carboxylate
| 상품명칭 |
Methyl 1,2,3-benzotriazole-5-carboxylate |
| 영문 이름 |
Methyl 1,2,3-benzotriazole-5-carboxylate; Methyl 1H-1,2,3-benzotriazole-5-carboxylate; methyl 2H-benzotriazole-5-carboxylate |
| 분자식 |
C8H7N3O2 |
| 분자량 |
177.1601 |
| InChI |
InChI=1/C8H7N3O2/c1-13-8(12)5-2-3-6-7(4-5)10-11-9-6/h2-4H,1H3,(H,9,10,11) |
| cas번호 |
113053-50-2 |
| 분자 구조 |
|
| 밀도 |
1.403g/cm3 |
| 녹는 점 |
169-179℃ |
| 비등점 |
349.3°C at 760 mmHg |
| 굴절 지수 |
1.658 |
| 인화점 |
165.1°C |
| 증기압 |
4.74E-05mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
