1135-12-2 4-Aminodiphenylmethane
상품명칭 |
4-Aminodiphenylmethane |
영문 이름 |
4-Aminodiphenylmethane; 4-Benzylaniline; 1,1,2,2-tetramethyl-3,4-di(propan-2-ylidene)cyclobutane |
분자식 |
C13H13N |
분자량 |
183.249 |
InChI |
InChI=1/C13H13N/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10,14H2 |
cas번호 |
1135-12-2 |
분자 구조 |
|
밀도 |
1.07g/cm3 |
비등점 |
300°C at 760 mmHg |
굴절 지수 |
1.616 |
인화점 |
159.5°C |
증기압 |
0.00115mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|