ChemNet > CAS > 1135-67-7 1-Phenyl-1-cyclohexanecarboxylic acid
1135-67-7 1-Phenyl-1-cyclohexanecarboxylic acid
상품명칭 |
1-Phenyl-1-cyclohexanecarboxylic acid |
영문 이름 |
1-Phenyl-1-cyclohexanecarboxylic acid;1-Phenylcyclohexane-1-carboxylic acid; 1-phenylcyclohexanecarboxylic acid; 1-phenylcyclohexanecarboxylate |
분자식 |
C13H15O2 |
분자량 |
203.2575 |
InChI |
InChI=1/C13H16O2/c14-12(15)13(9-5-2-6-10-13)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2,(H,14,15)/p-1 |
cas번호 |
1135-67-7 |
EC번호 |
214-495-8 |
분자 구조 |
|
녹는 점 |
119-124℃ |
비등점 |
353.9°C at 760 mmHg |
인화점 |
164.9°C |
증기압 |
1.28E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|