117-34-0 Diphenylacetic acid
상품명칭 |
Diphenylacetic acid |
영문 이름 |
Diphenylacetic acid; Benzeneacetic acid, alpha-phenyl-; 2,2-Diphenylacetic Acid |
분자식 |
C14H12O2 |
분자량 |
212.2439 |
InChI |
InChI=1/C14H12O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,15,16) |
cas번호 |
117-34-0 |
EC번호 |
204-185-0 |
분자 구조 |
|
밀도 |
1.174g/cm3 |
녹는 점 |
147-149℃ |
비등점 |
285°C at 760 mmHg |
굴절 지수 |
1.599 |
인화점 |
140.4°C |
증기압 |
0.00135mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|