상품명칭 |
3,3',4',5,7-pentahydroxyflavone |
영문 이름 |
3,3',4',5,7-pentahydroxyflavone;C.I. 75670; C.I. Natural Yellow 10; Quercetin; 3,3,4,5,7-Pentahydroxyflavone (pract); 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one; 3-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4H-chromen-4-one |
분자식 |
C15H10O6 |
분자량 |
286.2363 |
InChI |
InChI=1/C15H10O6/c16-8-4-12(19)14-13(5-8)21-6-9(15(14)20)7-1-2-10(17)11(18)3-7/h1-6,16-19H |
cas번호 |
117-39-5 |
EC번호 |
204-187-1 |
분자 구조 |
|
밀도 |
1.654g/cm3 |
녹는 점 |
314-317℃ |
비등점 |
616.1°C at 760 mmHg |
굴절 지수 |
1.767 |
인화점 |
239.5°C |
물 용해도 |
<0.1 g/100 mL at 21℃ |
증기압 |
9.03E-16mmHg at 25°C |
위험성 표시 |
T:Toxic;
|
리스크 규칙 |
R25:Toxic if swallowed.;
R40:Possible risks of irreversible effects.;
|
보안 규칙 |
S28:After contact with skin, wash immediately with plenty of ...;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|