ChemNet > CAS > 1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
상품명칭 |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane |
영문 이름 |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane; |
분자식 |
C7H11FO2 |
분자량 |
146.1594 |
InChI |
InChI=1/C7H11FO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5H2,(H,9,10) |
cas번호 |
1171-47-7 |
분자 구조 |
|
밀도 |
1.159g/cm3 |
비등점 |
227.566°C at 760 mmHg |
굴절 지수 |
1.454 |
인화점 |
91.429°C |
증기압 |
0.028mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|