ChemNet > CAS > 117695-55-3 3,5-Dibromobenzeneboronic acid
117695-55-3 3,5-Dibromobenzeneboronic acid
상품명칭 |
3,5-Dibromobenzeneboronic acid |
영문 이름 |
3,5-Dibromobenzeneboronic acid; 3,5-Dibromophenylboronic acid; 3,5-dibrombenzolboronsaeure; 3,5-Dibromophenyl boronic acid |
분자식 |
C6H5BBr2O2 |
분자량 |
279.7217 |
InChI |
InChI=1/C6H5BBr2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,10-11H |
cas번호 |
117695-55-3 |
분자 구조 |
|
밀도 |
2.09g/cm3 |
녹는 점 |
300℃ |
비등점 |
382.8°C at 760 mmHg |
굴절 지수 |
1.651 |
인화점 |
185.3°C |
증기압 |
1.52E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|