ChemNet > CAS > 1190-92-7 1-Dimethylamino-2-nitroethylene
1190-92-7 1-Dimethylamino-2-nitroethylene
상품명칭 |
1-Dimethylamino-2-nitroethylene |
영문 이름 |
1-Dimethylamino-2-nitroethylene; 1-(dimethylamino)-2-nitroethylene; (E)-N,N-dimethyl-2-nitroethenamine; 1-Nitro-2-(dimethylamino)ethylene |
분자식 |
C4H8N2O2 |
분자량 |
116.1185 |
InChI |
InChI=1/C4H8N2O2/c1-5(2)3-4-6(7)8/h3-4H,1-2H3/b4-3+ |
cas번호 |
1190-92-7 |
분자 구조 |
|
밀도 |
1.073g/cm3 |
비등점 |
161.1°C at 760 mmHg |
굴절 지수 |
1.473 |
인화점 |
51.2°C |
증기압 |
2.31mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|