ChemNet > CAS > 1191-41-9 ethyl linolenate
1191-41-9 ethyl linolenate
| 상품명칭 |
ethyl linolenate |
| 영문 이름 |
ethyl linolenate; Linolenic acid ethyl ester; 9,12,15-Octadecatrienoic acid ethyl ester; ethyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate; ethyl (9E,12E,15E)-octadeca-9,12,15-trienoate |
| 분자식 |
C20H34O2 |
| 분자량 |
306.4828 |
| InChI |
InChI=1/C20H34O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h5-6,8-9,11-12H,3-4,7,10,13-19H2,1-2H3/b6-5+,9-8+,12-11+ |
| cas번호 |
1191-41-9 |
| EC번호 |
214-734-6 |
| 분자 구조 |
|
| 밀도 |
0.893g/cm3 |
| 비등점 |
374.4°C at 760 mmHg |
| 굴절 지수 |
1.475 |
| 인화점 |
100.7°C |
| 증기압 |
8.35E-06mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
