1193-82-4 Methyl phenyl sulfoxide
상품명칭 |
Methyl phenyl sulfoxide |
영문 이름 |
Methyl phenyl sulfoxide; Methyl phenyl sulphoxide; (methylsulfinyl)benzene |
분자식 |
C7H8OS |
분자량 |
140.2028 |
InChI |
InChI=1/C7H8OS/c1-9(8)7-5-3-2-4-6-7/h2-6H,1H3 |
cas번호 |
1193-82-4 |
EC번호 |
214-781-2 |
분자 구조 |
|
밀도 |
1.19g/cm3 |
녹는 점 |
34-94℃ |
비등점 |
271.2°C at 760 mmHg |
굴절 지수 |
1.605 |
인화점 |
117.8°C |
증기압 |
0.0109mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|