ChemNet > CAS > 1198-47-6 2-Amino-6-methylmercaptopurine
1198-47-6 2-Amino-6-methylmercaptopurine
상품명칭 |
2-Amino-6-methylmercaptopurine |
영문 이름 |
2-Amino-6-methylmercaptopurine; |
분자식 |
C6H7N5S |
분자량 |
181.2183 |
InChI |
InChI=1/C6H7N5S/c1-12-5-3-4(9-2-8-3)10-6(7)11-5/h2-3H,1H3,(H2,7,8,9,10) |
cas번호 |
1198-47-6 |
EC번호 |
214-833-4 |
분자 구조 |
|
밀도 |
1.78g/cm3 |
녹는 점 |
234-237℃ |
비등점 |
344.1°C at 760 mmHg |
굴절 지수 |
1.892 |
인화점 |
161.9°C |
증기압 |
6.74E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|