ChemNet > CAS > 1202-25-1 Methyl 4-dimethylaminobenzoate
1202-25-1 Methyl 4-dimethylaminobenzoate
상품명칭 |
Methyl 4-dimethylaminobenzoate |
영문 이름 |
Methyl 4-dimethylaminobenzoate; 4-Dimethylaminobenzoic acid methyl ester |
분자식 |
C10H13NO2 |
분자량 |
179.2157 |
InChI |
InChI=1/C10H13NO2/c1-11(2)9-6-4-8(5-7-9)10(12)13-3/h4-7H,1-3H3 |
cas번호 |
1202-25-1 |
EC번호 |
214-863-8 |
분자 구조 |
|
밀도 |
1.084g/cm3 |
녹는 점 |
100-102℃ |
비등점 |
280.3°C at 760 mmHg |
굴절 지수 |
1.545 |
인화점 |
112.6°C |
증기압 |
0.00381mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|