ChemNet > CAS > 1202-39-7 3,4-Dichlorocinnamic acid
1202-39-7 3,4-Dichlorocinnamic acid
상품명칭 |
3,4-Dichlorocinnamic acid |
영문 이름 |
3,4-Dichlorocinnamic acid; 2-Propenoic acid, 3-(3,4-dichlorophenyl)-; 3-(3,4-Dichlorophenyl)-2-propenoic acid; BRN 1872129; NSC 518800; UNII-480625A7SY; 3',4'-Dichlorocinnamic acid; Cinnamic acid, 3,4-dichloro-; 3-(3,4-dichlorophenyl)prop-2-enoic acid; (2E)-3-(3,4-dichlorophenyl)prop-2-enoic acid |
분자식 |
C9H6Cl2O2 |
분자량 |
217.0487 |
InChI |
InChI=1/C9H6Cl2O2/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5H,(H,12,13)/b4-2+ |
cas번호 |
1202-39-7 |
EC번호 |
214-866-4 |
분자 구조 |
|
밀도 |
1.457g/cm3 |
녹는 점 |
218-220℃ |
비등점 |
366.6°C at 760 mmHg |
굴절 지수 |
1.637 |
인화점 |
175.5°C |
증기압 |
5.07E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|