ChemNet > CAS > 120355-50-2 2,6-Dichloro-beta-nitrostyrene
120355-50-2 2,6-Dichloro-beta-nitrostyrene
| 상품명칭 |
2,6-Dichloro-beta-nitrostyrene |
| 영문 이름 |
2,6-Dichloro-beta-nitrostyrene; 1-(2,6-Dichlorophenyl)-2-nitroethene; 1,3-dichloro-2-[(E)-2-nitroethenyl]benzene |
| 분자식 |
C8H5Cl2NO2 |
| 분자량 |
218.0368 |
| InChI |
InChI=1/C8H5Cl2NO2/c9-7-2-1-3-8(10)6(7)4-5-11(12)13/h1-5H/b5-4+ |
| cas번호 |
120355-50-2 |
| 분자 구조 |
|
| 밀도 |
1.447g/cm3 |
| 비등점 |
330.6°C at 760 mmHg |
| 굴절 지수 |
1.626 |
| 인화점 |
153.7°C |
| 증기압 |
0.000316mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
