ChemNet > CAS > 120355-50-2 2,6-Dichloro-beta-nitrostyrene
120355-50-2 2,6-Dichloro-beta-nitrostyrene
상품명칭 |
2,6-Dichloro-beta-nitrostyrene |
영문 이름 |
2,6-Dichloro-beta-nitrostyrene; 1-(2,6-Dichlorophenyl)-2-nitroethene; 1,3-dichloro-2-[(E)-2-nitroethenyl]benzene |
분자식 |
C8H5Cl2NO2 |
분자량 |
218.0368 |
InChI |
InChI=1/C8H5Cl2NO2/c9-7-2-1-3-8(10)6(7)4-5-11(12)13/h1-5H/b5-4+ |
cas번호 |
120355-50-2 |
분자 구조 |
|
밀도 |
1.447g/cm3 |
비등점 |
330.6°C at 760 mmHg |
굴절 지수 |
1.626 |
인화점 |
153.7°C |
증기압 |
0.000316mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|