ChemNet > CAS > 120935-94-6 methyl 4-bromo-2,5-dimethyl-1H-pyrrole-3-carboxylate
120935-94-6 methyl 4-bromo-2,5-dimethyl-1H-pyrrole-3-carboxylate
| 상품명칭 |
methyl 4-bromo-2,5-dimethyl-1H-pyrrole-3-carboxylate |
| 영문 이름 |
methyl 4-bromo-2,5-dimethyl-1H-pyrrole-3-carboxylate; |
| 분자식 |
C8H10BrNO2 |
| 분자량 |
232.0745 |
| InChI |
InChI=1/C8H10BrNO2/c1-4-6(8(11)12-3)7(9)5(2)10-4/h10H,1-3H3 |
| cas번호 |
120935-94-6 |
| 분자 구조 |
|
| 밀도 |
1.503g/cm3 |
| 비등점 |
344.5°C at 760 mmHg |
| 굴절 지수 |
1.558 |
| 인화점 |
162.2°C |
| 증기압 |
6.55E-05mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
