ChemNet > CAS > 1211-35-4 2-(4-chlorophenyl)-1H-indole
1211-35-4 2-(4-chlorophenyl)-1H-indole
상품명칭 |
2-(4-chlorophenyl)-1H-indole |
영문 이름 |
2-(4-chlorophenyl)-1H-indole; 2-(4-Chlorophenyl)indole |
분자식 |
C14H10ClN |
분자량 |
227.6889 |
InChI |
InChI=1/C14H10ClN/c15-12-7-5-10(6-8-12)14-9-11-3-1-2-4-13(11)16-14/h1-9,16H |
cas번호 |
1211-35-4 |
분자 구조 |
|
밀도 |
1.271g/cm3 |
비등점 |
417.8°C at 760 mmHg |
굴절 지수 |
1.684 |
인화점 |
239°C |
증기압 |
8.36E-07mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|