ChemNet > CAS > 121219-12-3 4-n-Pentylbenzeneboronic acid
121219-12-3 4-n-Pentylbenzeneboronic acid
| 상품명칭 |
4-n-Pentylbenzeneboronic acid |
| 영문 이름 |
4-n-Pentylbenzeneboronic acid; 4-n-Amylbenzeneboronic acid; 4-n-Pentylphenylboronic acid; (4-pentylphenyl)boronic acid; 4-Pentylbenzeneboronic acid |
| 분자식 |
C11H17BO2 |
| 분자량 |
192.0625 |
| InChI |
InChI=1/C11H17BO2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h6-9,13-14H,2-5H2,1H3 |
| cas번호 |
121219-12-3 |
| 분자 구조 |
|
| 밀도 |
1.01g/cm3 |
| 비등점 |
328°C at 760 mmHg |
| 굴절 지수 |
1.509 |
| 인화점 |
152.2°C |
| 증기압 |
7.85E-05mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
