ChemNet > CAS > 123334-29-2 코발트 (II) 2,4- 펜탄 디오 네이트
123334-29-2 코발트 (II) 2,4- 펜탄 디오 네이트
| 상품명칭 |
코발트 (II) 2,4- 펜탄 디오 네이트 |
| 별명 |
; 코발트 (II) 아세틸 아세토 네이트 수화물; 코발타세틸아세토네이트수화물분홍색 분말; 비스(아세틸아세토나토)코발트(II) 수화물~비스(2,4-펜타네디오나토)코발트(II) 수화물~코발트(II) 2,4-펜탄디오네이트 수화물; 2-펜텐-2-올레이트, 4-옥소-, (2Z)-, 코발트(2 ) 소금, 수화물(1:1:1); 코발트 아세틸 아세토 네이트 수화물 |
| 영문 이름 |
Cobalt(II)2,4-pentanedionate; Cobalt(II) acetylacetonate hydrate; Cobaltacetylacetonatehydratepinkpowder; Bis(acetylacetonato)cobalt(II) hydrate~Bis(2,4-pentanedionato)cobalt(II) hydrate~Cobalt(II) 2,4-pentanedionate hydrate; 2-penten-2-olate, 4-oxo-, (2Z)-, cobalt(2+) salt, hydrate (1:1:1); Cobalt acetylacetonate hydrate |
| 분자식 |
C5H9CoO3 |
| 분자량 |
176.0558 |
| InChI |
InChI=1/C5H8O2.Co.H2O/c1-4(6)3-5(2)7;;/h3,6H,1-2H3;;1H2/q;+2;/p-1/b4-3-;; |
| cas번호 |
123334-29-2 |
| 분자 구조 |
|
| 리스크 규칙 |
R22:Harmful if swallowed.;
R42/43:May cause sensitization by inhalation and skin contact.;
R49:May cause cancer by inhalation.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|