124-10-7 Methyl myristate
상품명칭 |
Methyl myristate |
영문 이름 |
Methyl myristate; Methyl tetradecanoate; methyl myristate 99%; Myristic Acid Methyl Ester; Tetradecanoic acid methyl ester |
분자식 |
C15H30O2 |
분자량 |
242.40 |
InChI |
InChI=1/C15H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2/h3-14H2,1-2H3 |
cas번호 |
124-10-7 |
EC번호 |
204-680-1 |
분자 구조 |
|
밀도 |
0.863 |
녹는 점 |
18.4-20℃ |
비등점 |
323℃ |
굴절 지수 |
1.434-1.438 |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|