ChemNet > CAS > 131738-73-3 1-Bromo-3-isopropoxybenzene
131738-73-3 1-Bromo-3-isopropoxybenzene
상품명칭 |
1-Bromo-3-isopropoxybenzene |
영문 이름 |
1-Bromo-3-isopropoxybenzene; 2-(3-Bromophenoxy)propane~3-Bromophenyl isopropyl ether; 3-Bromophenyl isopropyl ether; 1-bromo-3-(1-methylethoxy)benzene |
분자식 |
C9H11BrO |
분자량 |
215.087 |
InChI |
InChI=1/C9H11BrO/c1-7(2)11-9-5-3-4-8(10)6-9/h3-7H,1-2H3 |
cas번호 |
131738-73-3 |
분자 구조 |
|
밀도 |
1.319g/cm3 |
비등점 |
232°C at 760 mmHg |
굴절 지수 |
1.523 |
인화점 |
104.2°C |
증기압 |
0.0919mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|