ChemNet > CAS > 13194-73-5 3,5-Dibromo-4-methylaniline
13194-73-5 3,5-Dibromo-4-methylaniline
상품명칭 |
3,5-Dibromo-4-methylaniline |
영문 이름 |
3,5-Dibromo-4-methylaniline; 3,5-Dibromo-p-toluidine |
분자식 |
C7H7Br2N |
분자량 |
264.9452 |
InChI |
InChI=1/C7H7Br2N/c1-4-6(8)2-5(10)3-7(4)9/h2-3H,10H2,1H3 |
cas번호 |
13194-73-5 |
분자 구조 |
|
밀도 |
1.887g/cm3 |
비등점 |
308.8°C at 760 mmHg |
굴절 지수 |
1.641 |
인화점 |
140.6°C |
증기압 |
0.000664mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|