13228-39-2 N-Ethyl-2-phenylindole
상품명칭 |
N-Ethyl-2-phenylindole |
영문 이름 |
N-Ethyl-2-phenylindole; 1-Ethyl-2-phenylindole; 1-ethyl-2-phenyl-1H-indole |
분자식 |
C16H15N |
분자량 |
221.297 |
InChI |
InChI=1/C16H15N/c1-2-17-15-11-7-6-10-14(15)12-16(17)13-8-4-3-5-9-13/h3-12H,2H2,1H3 |
cas번호 |
13228-39-2 |
EC번호 |
236-199-8 |
분자 구조 |
|
밀도 |
1.03g/cm3 |
비등점 |
390.6°C at 760 mmHg |
굴절 지수 |
1.59 |
인화점 |
190°C |
증기압 |
5.91E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|