ChemNet > CAS > 132898-95-4 2,2'-비티오펜-5-보론산
132898-95-4 2,2'-비티오펜-5-보론산
| 상품명칭 |
2,2'-비티오펜-5-보론산 |
| 별명 |
2,2'-비티오펜-5-일보론산 |
| 영문 이름 |
2,2'-bithiophene-5-boronic acid;2,2'-bithiophen-5-ylboronic acid |
| 분자식 |
C8H7BO2S2 |
| 분자량 |
210.081 |
| InChI |
InChI=1/C8H7BO2S2/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h1-5,10-11H |
| cas번호 |
132898-95-4 |
| 분자 구조 |
|
| 밀도 |
1.42g/cm3 |
| 녹는 점 |
127℃ |
| 비등점 |
416.1°C at 760 mmHg |
| 굴절 지수 |
1.658 |
| 인화점 |
205.5°C |
| 증기압 |
1.14E-07mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
