ChemNet > CAS > 133-11-9 Phenyl 4-aminosalicylate
133-11-9 Phenyl 4-aminosalicylate
| 상품명칭 |
Phenyl 4-aminosalicylate |
| 영문 이름 |
Phenyl 4-aminosalicylate; 4-Amino-2-hydroxybenzoic acid phenyl ester; Phenyl PAS; fenamisal; Phenyl Aminosalicylate;
; phenyl 4-amino-2-hydroxybenzoate |
| 분자식 |
C13H11NO3 |
| 분자량 |
229.2313 |
| InChI |
InChI=1/C13H11NO3/c14-9-6-7-11(12(15)8-9)13(16)17-10-4-2-1-3-5-10/h1-8,15H,14H2 |
| cas번호 |
133-11-9 |
| EC번호 |
205-092-8 |
| 분자 구조 |
|
| 밀도 |
1.32g/cm3 |
| 녹는 점 |
147-152℃ |
| 비등점 |
406.4°C at 760 mmHg |
| 굴절 지수 |
1.659 |
| 인화점 |
199.6°C |
| 증기압 |
3.48E-07mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
