ChemNet > CAS > 133-49-3 Penta-Chloro Thiophenol
133-49-3 Penta-Chloro Thiophenol
| 상품명칭 |
Penta-Chloro Thiophenol |
| 영문 이름 |
Penta-Chloro Thiophenol; Pentachlorobenzenethiol; Pentachlorothiophenol; 2,3,4,5,6-Pentachlorobenzenethiol; Benzenethiol,pentachloro- (6CI,7CI,8CI,9CI); Benzenethiol,2,3,4,5,6-pentachloro- |
| 분자식 |
C6HCl5S |
| 분자량 |
282.4021 |
| InChI |
InChI=1/C6HCl5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
| cas번호 |
133-49-3 |
| EC번호 |
205-107-8 |
| 분자 구조 |
|
| 밀도 |
1.745g/cm3 |
| 녹는 점 |
223-227℃ |
| 비등점 |
351.3°C at 760 mmHg |
| 굴절 지수 |
1.648 |
| 인화점 |
144.6°C |
| 증기압 |
8.41E-05mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/22:Harmful by inhalation and if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
